BD3133545
InositolNicotinate , 97% , 6556-11-2
CAS NO.：6556-11-2
Empirical Formula: C42H30N6O12
Molecular Weight: 810.72
MDL number: MFCD00006387
EINECS: 229-485-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB52.80 | In Stock |
|
| 100g | RMB160.00 | In Stock |
|
| 500g | RMB594.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-256 °C(lit.) |
| Boiling point: | 755.54°C (rough estimate) |
| Density | 1.3348 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Aqueous Acid (Slightly, Heated), DMSO (Slightly, Heated, Sonicated) |
| pka | 3.92±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Merck | 13,5002 |
| InChIKey | MFZCIDXOLLEMOO-GYSGTQPESA-N |
| SMILES | [C@@H]1(OC(C2=CC=CN=C2)=O)[C@@H](OC(C2=CC=CN=C2)=O)[C@H](OC(C2=CC=CN=C2)=O)[C@@H](OC(C2=CC=CN=C2)=O)[C@H](OC(C2=CC=CN=C2)=O)[C@@H]1OC(C1=CC=CN=C1)=O |
| LogP | 3.945 (est) |
Description and Uses
benzidine substitute
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | NM7535400 |
