BD1545032
4-Fluoro-N-methoxy-N-methylbenzamide , 97% , 116332-54-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB52.00 | In Stock |
|
| 10g | RMB92.80 | In Stock |
|
| 25g | RMB167.20 | In Stock |
|
| 100g | RMB655.20 | In Stock |
|
| 500g | RMB2726.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 301.6±25.0 °C(Predicted) |
| Density | 1.179±0.06 g/cm3(Predicted) |
| refractive index | 1.51 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | White to Yellow to Green |
| InChI | InChI=1S/C9H10FNO2/c1-11(13-2)9(12)7-3-5-8(10)6-4-7/h3-6H,1-2H3 |
| InChIKey | DSUFRPVVBZLHPI-UHFFFAOYSA-N |
| SMILES | C(N(OC)C)(=O)C1=CC=C(F)C=C1 |
Description and Uses
4-Fluoro-N-methoxy-N-methylbenzamide is a fluorinated aromatic. As an organofluorine compound, it can synthesise pyridyl heterocycles and photochromic compounds. 4-Fluoro-N-methoxy-N-methylbenzamide can form exocyclic fluorinating agents by reacting with iodides. It can form complexes with copper or zinc as a ligand and convert metal hydroxides into metal carbonyls as a carbonylative agent. As a phosphine, it can be converted into carboxylic acids through hydrolysis or oxidation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| HS Code | 2928009090 |
