BD1490732
2-Chloro-5-(chloromethyl)thiazole , 98% , 105827-91-6
CAS NO.：105827-91-6
Empirical Formula: C4H3Cl2NS
Molecular Weight: 168.04
MDL number: MFCD01073549
EINECS: 429-830-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB28.80 | In Stock |
|
| 100g | RMB85.60 | In Stock |
|
| 500g | RMB285.60 | In Stock |
|
| 1000g | RMB552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31 |
| Boiling point: | 268.6±32.0 °C(Predicted) |
| Density | 1.503±0.06 g/cm3(Predicted) |
| refractive index | n20/D1.571 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| pka | 0.19±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 5861439 |
| InChI | InChI=1S/C4H3Cl2NS/c5-1-3-2-7-4(6)8-3/h2H,1H2 |
| InChIKey | VRMUIVKEHJSADG-UHFFFAOYSA-N |
| SMILES | S1C(CCl)=CN=C1Cl |
| CAS DataBase Reference | 105827-91-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-(chloromethyl)thiazole is a useful synthetic intermediate used in the synthesis of Ritonavir (R535000)
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H311-H314-H317-H411 |
| Precautionary statements | P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P501 |
| Hazard Codes | Xi,N,T |
| Risk Statements | 36/37/38-51/53-43-34-24-22 |
| Safety Statements | 26-37-61-45-36/37/39 |
| RIDADR | 2922 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29349990 |
