BD1374432
3-Bromofuran-2-carboxylic acid , 97% , 14903-90-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB132.00 | In Stock |
|
| 250mg | RMB192.00 | In Stock |
|
| 1g | RMB482.40 | In Stock |
|
| 5g | RMB1976.80 | In Stock |
|
| 10g | RMB3613.60 | In Stock |
|
| 25g | RMB8011.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-129 °C |
| Boiling point: | 278.0±25.0 °C(Predicted) |
| Density | 1.891±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, DCM, Ethyl Acetate |
| form | Solid |
| pka | 2.77±0.20(Predicted) |
| color | Light Brown |
| InChI | InChI=1S/C5H3BrO3/c6-3-1-2-9-4(3)5(7)8/h1-2H,(H,7,8) |
| InChIKey | UZBGSJZFBUOJNE-UHFFFAOYSA-N |
| SMILES | O1C=CC(Br)=C1C(O)=O |
Description and Uses
3-Bromo-2-furoic Acid is an intermediate in the synthesis of selective α4β2 nicotinic acetylcholine receptor agonists used for the treatment of cognitive disorders.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-26-36/37/39 |
| HS Code | 2932190090 |
