BD1176732
4-Bromo-1-chloroisoquinoline , 97% , 66728-98-1
CAS NO.：66728-98-1
Empirical Formula: C9H5BrClN
Molecular Weight: 242.5
MDL number: MFCD00234469
EINECS: 676-392-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB27.20 | In Stock |
|
| 250mg | RMB66.40 | In Stock |
|
| 1g | RMB134.40 | In Stock |
|
| 5g | RMB589.60 | In Stock |
|
| 10g | RMB1094.40 | In Stock |
|
| 25g | RMB2493.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97 °C (decomp) |
| Boiling point: | 328.8±22.0 °C(Predicted) |
| Density | 1.673±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -0.02±0.31(Predicted) |
| InChI | InChI=1S/C9H5BrClN/c10-8-5-12-9(11)7-4-2-1-3-6(7)8/h1-5H |
| InChIKey | HRWILRGBDZGABZ-UHFFFAOYSA-N |
| SMILES | C1(Cl)C2=C(C=CC=C2)C(Br)=CN=1 |
Description and Uses
4-Bromo-1-chloroisoquinoline is an isoquinoline derivative whose molecular structure contains substituents chlorine and bromine atoms at positions 1 and 4. The product can be used in metal-catalysed cross-coupling reactions and in the preparation of pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2933499090 |
