BD1024532
(2-Amino-5-bromophenyl)(pyridin-2-yl)methanone , 98% , 1563-56-0
CAS NO.：1563-56-0
Empirical Formula: C12H9BrN2O
Molecular Weight: 277.12
MDL number: MFCD07780283
EINECS: 216-352-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB41.60 | In Stock |
|
| 5g | RMB123.20 | In Stock |
|
| 10g | RMB238.40 | In Stock |
|
| 25g | RMB492.00 | In Stock |
|
| 100g | RMB1582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100℃ |
| Boiling point: | 451℃ |
| Density | 1.546 |
| Flash point: | 227℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 2.66±0.10(Predicted) |
| color | Light Yellow to Yellow |
| InChI | InChI=1S/C12H9BrN2O/c13-8-4-5-10(14)9(7-8)12(16)11-3-1-2-6-15-11/h1-7H,14H2 |
| InChIKey | KHVZPFKJBLTYCC-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Br)=CC=C1N)(C1=NC=CC=C1)=O |
Description and Uses
Intermediate in the preparation of Bromazepam.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933399990 |
