A2428412
2-(Chloromethyl)-3,4-dimethoxypyridine hydrochloride , 98% , 72830-09-2
CAS NO.：72830-09-2
Empirical Formula: C8H11Cl2NO2
Molecular Weight: 224.08
MDL number: MFCD02181083
EINECS: 416-440-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB153.60 | In Stock |
|
| 500g | RMB752.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly, Heated), Methanol (Very Slightly) |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 5360726 |
| InChI | InChI=1S/C8H10ClNO2.ClH/c1-11-7-3-4-10-6(5-9)8(7)12-2;/h3-4H,5H2,1-2H3;1H |
| InChIKey | YYRIKJFWBIEEDH-UHFFFAOYSA-N |
| SMILES | C1(CCl)=[NH+]C=CC(OC)=C1OC.[Cl-] |
Description and Uses
2-(Chloromethyl)-3,4-dimethoxypyridine hydrochloride may be used as a precursor for the preparation [(2-pyridyl)-2-ethyl]-[3,4-dimethoxy-(2-pyridylmethyl)]-N-methylamine.
Safety
| Symbol(GHS) |     GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H312-H315-H317-H318-H373-H411 |
| Precautionary statements | P273-P280-P305+P351+P338 |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 21/22-38-41-43-48/22-51/53 |
| Safety Statements | 26-36/37/39-61-2 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2933399932 |
