PRODUCT Properties
| Melting point: | 146-148 °C(Solv: water, 20% (7732-18-5); acetic acid (64-19-7); ethanol (64-17-5)) |
| Boiling point: | 345.3±45.0 °C(Predicted) |
| Density | 1.398±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 3.41±0.10(Predicted) |
| InChI | InChI=1S/C5H6ClN3O/c1-10-3-2-8-5(7)9-4(3)6/h2H,1H3,(H2,7,8,9) |
| InChIKey | OXAYXWLBMCQAJC-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(OC)C(Cl)=N1 |
Description and Uses
4-Chloro-5-methoxypyrimidin-2-amine is a pyrimidine derivative used as a pharmaceutical intermediate for pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
