BD0813053
(R)-N-(1-Phenylethyl)acetamide , 97% , 36283-44-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5g | RMB155.20 | In Stock |
|
| 25g | RMB477.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-103 °C |
| Boiling point: | 290.31°C (rough estimate) |
| Density | 1.007 |
| refractive index | 1.5400 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform, DMSO |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | PAVMRYVMZLANOQ-MRVPVSSYSA-N |
| SMILES | C(N[C@@H](C1=CC=CC=C1)C)(=O)C |
Description and Uses
N-[(R)-1-Phenylethyl]acetamide (cas# 36283-44-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
