BD0740832
1-(6-Methylpyridin-3-yl)-2-(4-(methylsulfonyl)phenyl)ethanone , 97% , 221615-75-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB93.60 | In Stock |
|
| 5g | RMB296.80 | In Stock |
|
| 10g | RMB449.60 | In Stock |
|
| 25g | RMB901.60 | In Stock |
|
| 100g | RMB2274.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >169oC (dec.) |
| Boiling point: | 509.7±50.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 3.75±0.10(Predicted) |
| form | Solid |
| color | Pale Beige |
| InChI | InChI=1S/C15H15NO3S/c1-11-3-6-13(10-16-11)15(17)9-12-4-7-14(8-5-12)20(2,18)19/h3-8,10H,9H2,1-2H3 |
| InChIKey | YBFHILNBYXCJKD-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(C)N=C1)CC1=CC=C(S(C)(=O)=O)C=C1 |
Description and Uses
This compound is an impurity in the synthesis of Etoricoxib (E934100), a specific inhibitor of COX-2 .
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
