BD0648432
4-Amino-2-methylpyrimidine-5-carbonitrile , 97% , 698-29-3
CAS NO.：698-29-3
Empirical Formula: C6H6N4
Molecular Weight: 134.14
MDL number: MFCD00084875
EINECS: 211-814-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB25.60 | In Stock |
|
| 1g | RMB80.80 | In Stock |
|
| 5g | RMB332.80 | In Stock |
|
| 10g | RMB598.40 | In Stock |
|
| 25g | RMB1281.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 249 °C |
| Boiling point: | 315.6±27.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO, Ethanol, Methanol |
| pka | 3.00±0.10(Predicted) |
| form | Powder |
| color | Pale yellow |
| Water Solubility | Slightly soluble in water (6.4 g/L at 25°C). Soluble in dimethyl sulfoxide, ethanol and methanol. |
| InChI | InChI=1S/C6H6N4/c1-4-9-3-5(2-7)6(8)10-4/h3H,1H3,(H2,8,9,10) |
| InChIKey | YBPNIILOUYAGIF-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(C#N)C(N)=N1 |
| CAS DataBase Reference | 698-29-3(CAS DataBase Reference) |
Description and Uses
4-Amino-5-cyano-2-methylpyrimidine is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2933599590 |
