BD0517232
(2,4,6-Trifluorophenyl)methanamine , 95% , 214759-21-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB77.60 | In Stock |
|
| 5g | RMB308.00 | In Stock |
|
| 10g | RMB543.20 | In Stock |
|
| 25g | RMB1265.60 | In Stock |
|
| 100g | RMB3968.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 165℃ |
| Density | 1.320 |
| Flash point: | 63℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.16±0.10(Predicted) |
| form | liquid |
| color | Colourless |
| Water Solubility | Slightly Soluble in water (1.2 g/L) (25°C). |
| Sensitive | Air Sensitive |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C7H6F3N/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2H,3,11H2 |
| InChIKey | RCHOKTKXVKKNBC-UHFFFAOYSA-N |
| SMILES | C1(CN)=C(F)C=C(F)C=C1F |
Description and Uses
2,4,6-Trifluorobenzylamine can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 20-26-36/37/39-45 |
| RIDADR | UN2735 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2921490090 |
