BD0433445
cis-Methyl4-hydroxycyclohexanecarboxylate , 98% , 3618-03-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.80 | In Stock |
|
| 1g | RMB120.00 | In Stock |
|
| 5g | RMB585.60 | In Stock |
|
| 25g | RMB2824.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 233.3±33.0℃ (760 Torr) |
| Density | 1.121±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.4705 (589.3 nm 21.5℃) |
| Flash point: | 93.5±18.2℃ |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | 14.96±0.40(Predicted) |
| InChI | InChI=1S/C8H14O3/c1-11-8(10)6-2-4-7(9)5-3-6/h6-7,9H,2-5H2,1H3/t6-,7+ |
| InChIKey | HYDYVXROZHFTGB-KNVOCYPGSA-N |
| SMILES | [C@@H]1(C(OC)=O)CC[C@H](O)CC1 |
Description and Uses
Methyl 4-hydroxycyclohexylcarboxylate is a carboxylate derivative and can be used as an organic intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330 |
| HS Code | 2918199890 |
