BD0079548
2-Oxoindoline-5-carbonitrile , 95% , 61394-50-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB204.00 | In Stock |
|
| 250mg | RMB348.00 | In Stock |
|
| 1g | RMB916.80 | In Stock |
|
| 5g | RMB3218.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-239°C |
| Boiling point: | 389.7±42.0 °C(Predicted) |
| Density | 1.33 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.84±0.20(Predicted) |
| form | solid |
| color | Off White |
| InChI | InChI=1S/C9H6N2O/c10-5-6-1-2-8-7(3-6)4-9(12)11-8/h1-3H,4H2,(H,11,12) |
| InChIKey | NZOSLRYUVHMXTQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(C#N)C=C2)CC1=O |
Description and Uses
2-Oxoindoline-5-carbonitrile is used as a reactant in the preparation of indolinone-based kinase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P260-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38-43 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | 3439 |
| Hazard Note | Irritant |
| HS Code | 2933790090 |
