A8411612
5-Fluoro-2-iodobenzoic acid , 97% , 52548-63-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB182.40 | In Stock |
|
| 25g | RMB692.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-149 °C |
| Boiling point: | 307.9±27.0 °C(Predicted) |
| Density | 2.074±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.52±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H4FIO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | XPFMQYOPTHMSJJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1I |
Description and Uses
5-Fluoro-2-iodobenzoic acid is an important intermediate for the production of pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2916310090 |
