A8355012
N-Vinyl carbazole , 98% , 1484-13-5
CAS NO.：1484-13-5
Empirical Formula: C14H11N
Molecular Weight: 193.24
MDL number: MFCD00004966
EINECS: 216-055-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 100G | RMB463.20 | In Stock |
|
| 250g | RMB1039.20 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-65 °C(lit.) |
| Boiling point: | 154-155 °C3 mm Hg(lit.) |
| Density | 1,085 g/cm3 |
| refractive index | 1.5850 (estimate) |
| Flash point: | 182℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in acetonitrile. |
| form | Crystalline Powder |
| color | Off-white to yellow |
| BRN | 132988 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C14H11N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h2-10H,1H2 |
| InChIKey | KKFHAJHLJHVUDM-UHFFFAOYSA-N |
| SMILES | N1(C=C)C2=C(C=CC=C2)C2=C1C=CC=C2 |
Description and Uses
Polymerizes to form heat-resistant and insulating resins somewhat similar to mica in dielectric properties.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H312-H315-H317-H341-H410 |
| Precautionary statements | P202-P261-P273-P280-P301+P310-P302+P352+P312 |
| Hazard Codes | Xn,N |
| Risk Statements | 21/22-38-43-50/53-68 |
| Safety Statements | 22-23-36/37-60-61 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | FE6350000 |
| TSCA | Yes |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29339900 |
