A8037212
Thioflavin T , 2390-54-7
Synonym(s):
Basic Yellow 1;Thioflavin T - CAS 2390-54-7 - Calbiochem;Thioflavine T;Thioflavine T (C.I.No.49005);ThT, Thioflavine T, Basic Yellow 1
CAS NO.：2390-54-7
Empirical Formula: C17H19ClN2S
Molecular Weight: 318.86
MDL number: MFCD00011944
EINECS: 219-228-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB41.60 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 10g | RMB179.20 | In Stock |
|
| 25G | RMB287.20 | In Stock |
|
| 100G | RMB528.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-212 °C (decomp) |
| Density | 1.301g/cm3 at 20℃ |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Store below +30°C. |
| solubility | methanol: soluble1mg/mL |
| form | Powder |
| Colour Index | 49005 |
| color | Yellow to ochre-yellow |
| BRN | 3922452 |
| InChI | InChI=1S/C17H19N2S.ClH/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
| InChIKey | JADVWWSKYZXRGX-UHFFFAOYSA-M |
| SMILES | C1(=[N+](C)C2C=CC(C)=CC=2S1)C1C=CC(N(C)C)=CC=1.[Cl-] |
| LogP | 3.02 at 25℃ and pH7.98 |
Description and Uses
A dye used to visualize beta-amyloid plaques, like those associated with Alzheimer's Disease
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 32041300 |
