A7993312
3,4-Thiophenedicarboxylic Acid , >97.0% , 4282-29-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1G | RMB52.80 | In Stock |
|
| 5g | RMB187.20 | In Stock |
|
| 25g | RMB780.00 | In Stock |
|
| 100g | RMB2952.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-231 °C |
| Boiling point: | 272.46°C (rough estimate) |
| Density | 1.473 (estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 3.36±0.20(Predicted) |
| color | Yellow to beige-pinkish or light brown |
| λmax | 240nm(H2O)(lit.) |
| InChI | InChI=1S/C6H4O4S/c7-5(8)3-1-11-2-4(3)6(9)10/h1-2H,(H,7,8)(H,9,10) |
| InChIKey | ZWWLLYJRPKYTDF-UHFFFAOYSA-N |
| SMILES | C1SC=C(C(O)=O)C=1C(O)=O |
Description and Uses
Synthetic precursor for organic electronics materials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
