Triisopropylsilylacetylene , >95.0%(GC) , 89343-06-6
Synonym(s):
Ethynyltriisopropylsilane
CAS NO.：89343-06-6
Empirical Formula: C11H22Si
Molecular Weight: 182.38
MDL number: MFCD00075452
EINECS: 629-580-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB52.00 | In Stock |
|
| 5ML | RMB67.20 | In Stock |
|
| 25ML | RMB237.60 | In Stock |
|
| 100ML | RMB924.80 | In Stock |
|
| 500ml | RMB3599.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 50-51 °C |
| Boiling point: | 50-52 °C/0.6 mmHg (lit.) |
| Density | 0.813 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 133 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Miscible with organic solvents. |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 0.813 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3536241 |
| InChI | InChI=1S/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3 |
| InChIKey | KZGWPHUWNWRTEP-UHFFFAOYSA-N |
| SMILES | [Si](C#C)(C(C)C)(C(C)C)C(C)C |
Description and Uses
(Triisopropylsilyl)acetylene (TIPS-acetylene) is an easily handled and inexpensive monoprotected acetylene used as an attractive substitute for trimethylsilylacetylene (TMSacetylene). The bulkier silyl protecting group of TIPS-acetylene provides stability in a wider range of reaction conditions than TMS-acetylene. Its higher boiling point also provides better handling and safety than TMS-acetylene (bp 87–88°C at 12 hPa (9 mmHg)). The general utility of TIPS-acetylene is often highlighted in the transition metal-catalyzed C–C bond formations， including but not limited to transition metal-catalyzed Coupling Reactions；Reaction of TIPS-acetylide with Electrophiles；Synthesis of Polyynes；Transition Metal-catalyzed Cross-addition of TIPSacetylene to Alkynes；Hydroalkynylation；Direct Alkynylation；Conjugate Addition；Cycloaddition；Ring-opening Reactions etc.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | N |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
