A7917012
2-(Trifluoromethoxy)benzenesulfonamide , >98.0%(GC)(T) , 37526-59-3
CAS NO.：37526-59-3
Empirical Formula: C7H6F3NO3S
Molecular Weight: 241.19
MDL number: MFCD01320751
EINECS: 448-450-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB85.60 | In Stock |
|
| 100G | RMB292.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-125°C |
| Boiling point: | 312.4±52.0 °C(Predicted) |
| Density | 1.519 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.56±0.60(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C7H6F3NO3S/c8-7(9,10)14-5-3-1-2-4-6(5)15(11,12)13/h1-4H,(H2,11,12,13) |
| InChIKey | HIFGQHGWMTZMOH-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=CC=C1OC(F)(F)F |
| CAS DataBase Reference | 37526-59-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2-(Trifluoromethoxy)benzenesulfonamide (37526-59-3) |
Description and Uses
2-(Trifluoromethoxy)benzenesulfonamide can be used to treat cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-36/37/39-37-26 |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
