PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Density | 1.401±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated), Water (Slightly, Heated) |
| pka | 8.46±0.10(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | Soluble in water. (50 g/L ) at 20°C, DMSO, dimethyl formamide or 100% ethanol. |
| BRN | 125482 |
| InChI | InChI=1S/C5H6N2O3/c8-2-3-1-6-5(10)7-4(3)9/h1,8H,2H2,(H2,6,7,9,10) |
| InChIKey | JDBGXEHEIRGOBU-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(CO)C(=O)N1 |
| CAS DataBase Reference | 4433-40-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4(1H,3H)-Pyrimidinedione, 5-(hydroxymethyl)- (4433-40-3) |
Description and Uses
5-Hydroxymethyluracil is a product of oxidative damage to DNA, predominantly by hydroxyl radical via the Fenton reaction. It can be used as a potential epigenetic mark enhancing or inhibiting transcription with bacterial RNA polymerase.
5-Hydroxymethyluracil (cas# 4433-40-3) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | YR0513000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
