A7746058
Naringenin , 10mMinDMSO , 480-41-1
Synonym(s):
(±)-2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;(±)-Naringenin;4′,5,7-Trihydroxyflavanone
CAS NO.：480-41-1
Empirical Formula: C15H12O5
Molecular Weight: 272.25
MDL number: MFCD00870553
EINECS: 207-550-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-250 °C(lit.) |
| Boiling point: | 335.31°C (rough estimate) |
| Density | 1.2066 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| FEMA | 4797 | (+/-)-NARINGENIN |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Powder |
| pka | 7.52±0.40(Predicted) |
| color | Beige-brown |
| InChI | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2/t13-/m0/s1 |
| InChIKey | FTVWIRXFELQLPI-ZDUSSCGKSA-N |
| SMILES | [C@H]1(C2=CC=C(O)C=C2)OC2=CC(O)=CC(O)=C2C(=O)C1 |
| LogP | 2.520 |
Description and Uses
The aglucon of Naringin. Inhibitory mechanism of Naringenin against carcinogenic acrylamide formation and nonenzymic browning in Maillard model reactions
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
