A7731612
Thiamine pyrophosphate , 98% , 154-87-0
Synonym(s):
Cocarboxylase;Thiamine pyrophosphate;Thiamine pyrophosphate chloride;Cocarboxylase chloride;Thiaminium diphosphoric acid ester chloride, Thiaminium pyrophosphate chloride, Thiaminium pyrophosphoric acid ester chloride, TPP
CAS NO.：154-87-0
Empirical Formula: C12H19ClN4O7P2S
Molecular Weight: 460.767
MDL number: MFCD00038740
EINECS: 205-836-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB148.80 | In Stock |
|
| 5G | RMB335.20 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| 100G | RMB5279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240～241℃ |
| storage temp. | -20°C |
| solubility | H2O: soluble50mg/mL, clear to very slightly hazy, colorless |
| form | Solid |
| color | White to Off-White |
| Water Solubility | It is soluble in water. |
| BRN | 3875902 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C12H18N4O7P2S.ClH/c1-8-11(3-4-22-25(20,21)23-24(17,18)19)26-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7H,3-4,6H2,1-2H3,(H4-,13,14,15,17,18,19,20,21);1H |
| InChIKey | YXVCLPJQTZXJLH-UHFFFAOYSA-N |
| SMILES | [Cl-].S1C([H])=[N+](C([H])([H])C2=C([H])N=C(C([H])([H])[H])N=C2N([H])[H])C(C([H])([H])[H])=C1C([H])([H])C([H])([H])OP(=O)(O[H])OP(=O)(O[H])O[H] |
Description and Uses
Cocarboxylase can be used in decarboxylation mechanisms in biological systems,and to investigate radical reactions of thiamin pyrophosphate in 2-oxoacid oxidoreductases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| Safety Statements | 22-24/25 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | XI7552000 |
| F | 3-8-10 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29362200 |
| Toxicity | LD50 intramuscular in mouse: > 1gm/kg |
