PRODUCT Properties
| Melting point: | 156 °C |
| Boiling point: | 280-290 °C (dec.) |
| Density | 1.1031 (rough estimate) |
| refractive index | 1.5589 (estimate) |
| storage temp. | Refrigerator |
| solubility | Soluble in methanol. |
| pka | 16.21±0.40(Predicted) |
| form | Solid |
| color | Plates or leaflets |
| Merck | 14,7266 |
| InChI | InChI=1S/C8H9NO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | LSBDFXRDZJMBSC-UHFFFAOYSA-N |
| SMILES | C1(CC(N)=O)=CC=CC=C1 |
Description and Uses
In agriculture, 2-Phenylacetamid can be used in the production of many important intermediates of pesticides, such as carbamine. In the field of dyes: it can react with some monomers with color to produce some important raw materials for blue and purple dyes. In the field of fragrances, it can be used as an important raw material for the synthesis of certain spices and flavors. 2-Phenylacetamide can also be used in the synthesis of organometallic, organic peroxide, organic peroxide ester, and other compounds, and can be used as a crosslinking agent for polymers, a film forming agent for coatings, a plasticizer for plastics, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P280i-P301+P312a-P305+P351+P338-P337+P313-P501a |
| Hazard Codes | Xi |
| Risk Statements | 22-36 |
| Safety Statements | 22-24/25-60-36-26 |
| RTECS | AC7705000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Toxicity | LD50 ipr-mus: 430 mg/kg PCJOAU 10,579,76 |
