A7705312
1,2,3,5-Tetra-O-acetyl-β-D-ribofuranose , 98% , 13035-61-5
Synonym(s):
1,2,3,5-Tetra-O-acetyl-β-D -ribofuranose
CAS NO.：13035-61-5
Empirical Formula: C13H18O9
Molecular Weight: 318.28
MDL number: MFCD00005358
EINECS: 235-898-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB20.00 | In Stock |
|
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB43.20 | In Stock |
|
| 500G | RMB140.80 | In Stock |
|
| 2.5kg | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-83 °C(lit.) |
| alpha | -15.4 º (c=7, MeOH) |
| Boiling point: | 417.45°C (rough estimate) |
| Density | 1.4171 (rough estimate) |
| refractive index | -14.5 ° (C=5, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to almost white |
| optical activity | [α]26/D 11.4°, c = 10 in chloroform |
| BRN | 94078 |
| InChI | InChI=1/C13H18O9/c1-6(14)18-5-10-11(19-7(2)15)12(20-8(3)16)13(22-10)21-9(4)17/h10-13H,5H2,1-4H3/t10-,11-,12-,13-/s3 |
| InChIKey | TTXVPMATRDJQIA-BKUVIOGVSA-N |
| SMILES | [C@@H]1(OC(=O)C)[C@@H](COC(=O)C)O[C@@H](OC(=O)C)[C@@H]1OC(=O)C |&1:0,5,12,17,r| |
Description and Uses
Used in the synthesis of 3-(β-D-ribofuranosyl)-2,3-dihydro-6H-1,3-oxazine-2,6-dione, a new pyrimidine nucleoside analog related to uridine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29400090 |
