A7413912
(<i>S</i>,<i>S</i>)-(-)-Hydrobenzoin , >99.0%(GC) , 2325-10-2
Synonym(s):
(S,S)-(−)-1,2-Diphenyl-1,2-ethanediol;(S,S)-1,2-Diphenylethylene glycol
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB108.00 | In Stock |
|
| 1g | RMB215.20 | In Stock |
|
| 5G | RMB551.20 | In Stock |
|
| 25G | RMB1992.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C (lit.) |
| Boiling point: | 314.4°C (rough estimate) |
| alpha | [α]D20 -90～-95° (c=2.5, C2H5OH) |
| Density | 1.0781 (rough estimate) |
| refractive index | -95 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 13.38±0.20(Predicted) |
| form | Crystals |
| color | White |
| optical activity | [α]24/D 94°, c = 2.5 in ethanol |
| Merck | 14,4777 |
| BRN | 2330888 |
| InChI | InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m0/s1 |
| InChIKey | IHPDTPWNFBQHEB-KBPBESRZSA-N |
| SMILES | [C@@H](C1=CC=CC=C1)(O)[C@H](C1=CC=CC=C1)O |
Description and Uses
(S,S)-(-)-Hydrobenzoin is a chral auxiliary with versatile applications. It is also used as a building block.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29062990 |
