A7347112
Sodium 1-butanesulfonate , Ion to chromatography, ≥99.0%(t) , 2386-54-1
Synonym(s):
1-Butanesulfonic acid sodium salt;Butane-1-sulfonic acid sodium salt
CAS NO.：2386-54-1
Empirical Formula: C4H9NaO3S
Molecular Weight: 160.17
MDL number: MFCD00007540
EINECS: 219-201-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25G | RMB326.40 | In Stock |
|
| 100G | RMB900.80 | In Stock |
|
| 500G | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear to slightly hazy |
| form | Crystalline Powder |
| color | White to off-white |
| Odor | Odorless |
| Water Solubility | soluble |
| λmax | λ: 210 nm Amax: 0.1 λ: 220 nm Amax: 0.06 λ: 230 nm Amax: 0.04 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3716662 |
| InChI | InChI=1S/C4H10O3S.Na/c1-2-3-4-8(5,6)7;/h2-4H2,1H3,(H,5,6,7);/q;+1/p-1 |
| InChIKey | XQCHMGAOAWZUPI-UHFFFAOYSA-M |
| SMILES | C(CCC)S([O-])(=O)=O.[Na+] |
Description and Uses
Ion-associating reagent for HPLC, including analyses of peptides and proteins.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | Yes |
| HS Code | 29041000 |
