A7100412
4-Quinolinecarboxylic acid , 98% , 486-74-8
CAS NO.：486-74-8
Empirical Formula: C10H7NO2
Molecular Weight: 173.17
MDL number: MFCD00006782
EINECS: 207-640-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB132.80 | In Stock |
|
| 5G | RMB435.20 | In Stock |
|
| 25G | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-255 °C (lit.) |
| Boiling point: | 348.7±15.0 °C(Predicted) |
| Density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| pka | 1.03±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 5224 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H,12,13) |
| InChIKey | VQMSRUREDGBWKT-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=CC=1 |
| CAS DataBase Reference | 486-74-8(CAS DataBase Reference) |
Description and Uses
Quinoline-4-carboxylic Acid for small therapeutic agent compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | GD3850000 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
