A7093512
2,4-Quinolinediol , 97% , 86-95-3
Synonym(s):
2,4-Dihydroxyquinoline
CAS NO.：86-95-3
Empirical Formula: C9H7NO2
Molecular Weight: 161.16
MDL number: MFCD00006744
EINECS: 201-711-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB432.00 | In Stock |
|
| 500G | RMB2090.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 287.44°C (rough estimate) |
| Density | 1.2480 (rough estimate) |
| refractive index | 1.5050 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Aqueous Base (Slightly), DMSO (Slightly) |
| pka | 4.50±1.00(Predicted) |
| form | Powder |
| color | Very light brown |
| Water Solubility | Insoluble in water |
| BRN | 129767 |
| InChI | InChI=1S/C9H7NO2/c11-8-5-9(12)10-7-4-2-1-3-6(7)8/h1-5H,(H2,10,11,12) |
| InChIKey | HDHQZCHIXUUSMK-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(O)=CC1=O |
| LogP | 1.020 (est) |
Description and Uses
2,4-Quinolinediol is a coupling component of yellow azo dyes, also used as pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | FG7300000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
