A7093412
2-Quinoxalinol , 99% , 1196-57-2
CAS NO.：1196-57-2
Empirical Formula: C8H6N2O
Molecular Weight: 146.15
MDL number: MFCD00006722
EINECS: 214-815-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB141.60 | In Stock |
|
| 500G | RMB503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 271-272 °C (lit.) |
| Boiling point: | 265.75°C (rough estimate) |
| Density | 1.2312 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) |
| form | Solid |
| pka | 9.20±0.50(Predicted) |
| color | Light Brown |
| InChI | InChI=1S/C8H6N2O/c11-8-5-9-6-3-1-2-4-7(6)10-8/h1-5H,(H,10,11) |
| InChIKey | FFRYUAVNPBUEIC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)N=CC1=O |
| CAS DataBase Reference | 1196-57-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2(1H)-quinoxalinone(1196-57-2) |
| EPA Substance Registry System | 2(1H)-Quinoxalinone (1196-57-2) |
Description and Uses
2-Quinoxalinone is a metabolite of Quinalphos, and is known to photocatalytically destroy antioxidant vitamins and biogenic amines in vitro and is genotoxic to both light- and dark-exposed bacteria.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/39-37/39 |
| WGK Germany | 3 |
| RTECS | VD3630000 |
| HS Code | 29339900 |
| Toxicity | mouse,LD50,intravenous,178mg/kg (178mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#00285, |
