A7066258
3,3′-Diindolylmethane , 10mMinDMSO , 1968-05-4
Synonym(s):
3,3′-Bisindolylmethane;DIM
CAS NO.：1968-05-4
Empirical Formula: C17H14N2
Molecular Weight: 246.31
MDL number: MFCD00195766
EINECS: 100-201-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167 °C |
| Boiling point: | 230 °C(Press: 0.01 Torr) |
| Density | 1.271±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 16.91±0.30(Predicted) |
| form | Off-white powder. |
| color | White to Pale Beige |
| InChI | InChI=1S/C17H14N2/c1-3-7-16-14(5-1)12(10-18-16)9-13-11-19-17-8-4-2-6-15(13)17/h1-8,10-11,18-19H,9H2 |
| InChIKey | VFTRKSBEFQDZKX-UHFFFAOYSA-N |
| SMILES | C(C1C2=C(NC=1)C=CC=C2)C1C2=C(NC=1)C=CC=C2 |
| LogP | 4.401 (est) |
Description and Uses
3,3′-Diindolylmethane may be used as a model substrate to analyze the role of 3,3′-diindolylmethane in inducing apoptosis in human cancer cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| RTECS | NM0332000 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
