PRODUCT Properties
| Melting point: | >145oC (dec.) |
| Boiling point: | 196°C |
| Density | 2.49±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly), Water (Slightly) |
| pka | pK2: 4.2(-1);pK3: 7.20(-2) (25°C) |
| form | Solid |
| color | White to Off-White |
| Merck | 13,155 |
| BRN | 67722 |
| InChIKey | XTWYTFMLZFPYCI-KQYNXXCUSA-N |
| SMILES | C(OP(=O)(O)OP(O)(O)=O)[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](O)[C@@H]1O |
Description and Uses
Adenosine 5′-diphosphate (5′-ADP or ADP) was used as a test compound for studying the endothelium-dependent vascular response in salt sensitive (DS) and salt resistant Dahl rats (DR). The product was used to study the different P2-purinergic receptor subtypes on canine vascular smooth muscle and endothelium.
