5'-Adenylic Acid , 95% , 61-19-8
Synonym(s):
5′-Adenylic Acid;Adenosine 5′-monophosphate;AMP
CAS NO.：61-19-8
Empirical Formula: C10H14N5O7P
Molecular Weight: 347.22
MDL number: MFCD00005750
EINECS: 200-500-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB34.40 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 178-185 °C |
| Boiling point: | 798.5±70.0 °C(Predicted) |
| Density | 2.32±0.1 g/cm3(Predicted) |
| FEMA | 4224 | ADENOSINE MONOPHOSPHATE; MONOSODIUM, OR DISODIUM ADENYLATE |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | H2O: with addition of mild alkalisoluble |
| form | Crystalline Powder |
| pka | 3.8, 6.2(at 25℃) |
| color | Colorless to white |
| PH | 3.84 |
| Water Solubility | Soluble in water. |
| λmax | 257 (pH 1)；259 (pH 7) |
| Merck | 14,158 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | UDMBCSSLTHHNCD-KQYNXXCUSA-N |
| SMILES | P(OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](O)[C@@H]1O)(O)(O)=O |
| CAS DataBase Reference | 61-19-8(CAS DataBase Reference) |
| EPA Substance Registry System | 5'-Adenylic acid (61-19-8) |
Description and Uses
Adenosine-5'-monophosphoric acid is a nucleotide that is synthesized from adenosine triphosphate and inosine monophosphate. Adenosine-5'-monophosphoric acid is an important molecule in the body because it is a substrate for cyclic AMP, which regulates many cellular processes. Adenosine-5'-monophosphoric acid also has biochemical properties that are similar to those of the neurotransmitter serotonin and it can activate the 5-HT2 receptors.
Adenosine 5'-Monophosphate is a natural occurring nucleotide and a useful ligand determinant that facilitate the binding of APS reductase inhibitors and activates adenosine receptor agonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | AU7480500 |
| TSCA | Yes |
| HS Code | 29389090 |
| Hazardous Substances Data | 61-19-8(Hazardous Substances Data) |
| Toxicity | LD50 intraperitoneal in mouse: 4gm/kg |
