A7025158
(-)-Arctigenin , 10mMinDMSO , 7770-78-7
Synonym(s):
(−)-Arctigenin;(3R,4R)-4-[(3,4-Dimethoxyphenyl)methyl]dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2(3H)-furanone;2(3H)-Furanone
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98.0 to 102.0 °C |
| Boiling point: | 567.0±45.0 °C(Predicted) |
| Density | 1.227±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO: 34 mg/mL with heating and sonicating, soluble |
| form | solid |
| pka | 10.03±0.20(Predicted) |
| color | White to Light yellow |
| λmax | 280nm(EtOH)(lit.) |
| InChI | InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | NQWVSMVXKMHKTF-JKSUJKDBSA-N |
| SMILES | O1C[C@H](CC2=CC=C(OC)C(OC)=C2)[C@@H](CC2=CC=C(O)C(OC)=C2)C1=O |
| LogP | 2.470 (est) |
Description and Uses
Arctigenin is a plant ligan associated with anticancer and antioxidant properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LY9247000 |
| HS Code | 2932.20.4500 |
