PRODUCT Properties
| Melting point: | >300*C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water (Slightly) |
| form | Crystalline Powder |
| color | White to almost white |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H8O7.Na.H/c7-3(8)1-2(5(10)11)4(9)6(12)13;;/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13);; |
| InChIKey | PXOCFRDZUIKIIE-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)(CC(=O)O)C(O)C(=O)O.[NaH] |
Description and Uses
Isocitric acid is the protonated analogue of isocitrate, a substrate of the citric acid cycle.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H320-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29181990 |
