A6663812
Pyridinium chlorochromate , 98% , 26299-14-9
Synonym(s):
PCC
CAS NO.：26299-14-9
Empirical Formula: C5H6ClCrNO3
Molecular Weight: 215.55
MDL number: MFCD00013106
EINECS: 247-595-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB64.00 | In Stock |
|
| 500G | RMB278.40 | In Stock |
|
| 2.5kg | RMB1091.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-208 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in acetone, benzene, dichloromethane, acetonitrile and tetrahydrofuran. |
| form | Crystalline Powder |
| color | Orange |
| Sensitive | Moisture Sensitive |
| Merck | 14,7974 |
| BRN | 7054643 |
| Exposure limits | OSHA: Ceiling 0.1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 0.0002 mg/m3 |
| Stability: | Stable. May react with easily oxidized materials. Incompatible with reducing agents, combustible material, metals, strong reducing agents. |
| InChI | InChI=1S/C5H5N.ClH.Cr.3O/c1-2-4-6-5-3-1;;;;;/h1-5H;1H;;;; |
| InChIKey | LEHBURLTIWGHEM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC=C1.[Cr](=O)(=O)(=O)[Cl-].[H+] |
| CAS DataBase Reference | 26299-14-9(CAS DataBase Reference) |
| EPA Substance Registry System | Pyridinium chlorochromate (26299-14-9) |
Description and Uses
Oxidizing agent in organic synthesis.
PCC is pyridinium chlorochromate; PDC is pyridinium dichromate. Both are used in dichloromethane.
Safety
| Symbol(GHS) |     GHS03,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H272-H317-H350i-H410 |
| Precautionary statements | P201-P210-P273-P280-P302+P352-P308+P313 |
| Hazard Codes | O,T,N |
| Risk Statements | 49-8-43-50/53-20/21/22 |
| Safety Statements | 53-45-60-61-37-24-17-44-36/37/39-22 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 2 |
| TSCA | Yes |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29333990 |
