A6635112
4,4′-(1,3-Phenylenedioxy)dianiline , 98% , 2479-46-1
Synonym(s):
m -Bis(p -aminophenoxy)benzene;1,3-Bis(p -aminophenoxy)benzene;1,3-Bis(4-aminophenoxy)benzene;1,3-Phenylene bis(p -aminophenyl) ether;4,4′-(m -Phenylenedioxy)dianiline
CAS NO.：2479-46-1
Empirical Formula: C18H16N2O2
Molecular Weight: 292.33
MDL number: MFCD00039154
EINECS: 628-902-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB308.00 | In Stock |
|
| 500g | RMB1118.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-118 °C(lit.) |
| Boiling point: | 434.27°C (rough estimate) |
| Density | 1.1925 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | very faint turbidity in Acetonitrile |
| form | powder to crystal |
| pka | 5.06±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C18H16N2O2/c19-13-4-8-15(9-5-13)21-17-2-1-3-18(12-17)22-16-10-6-14(20)7-11-16/h1-12H,19-20H2 |
| InChIKey | WUPRYUDHUFLKFL-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=C(N)C=C2)=CC=CC(OC2=CC=C(N)C=C2)=C1 |
Description and Uses
1,3-Bis(4'-aminophenoxyl)benzene be used for the preparation of a polyimide material.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BY8236000 |
| HS Code | 29222990 |
