A6241812
5-Chloro-2-nitropyridine , 97% , 52092-47-4
CAS NO.：52092-47-4
Empirical Formula: C5H3ClN2O2
Molecular Weight: 158.54
MDL number: MFCD03092916
EINECS: 639-354-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100G | RMB395.20 | In Stock |
|
| 500g | RMB1560.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-123℃ |
| Boiling point: | 275.3±20.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -4.87±0.22(Predicted) |
| form | crystalline powder |
| color | White to very faint yellow |
| InChI | InChI=1S/C5H3ClN2O2/c6-4-1-2-5(7-3-4)8(9)10/h1-3H |
| InChIKey | YUBHMOQVHOODEI-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=C(Cl)C=C1 |
Description and Uses
5-Chloro-2-nitropyridine can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 20/21/22-36/37/38-50-41-22 |
| Safety Statements | 26-36/37/39-36-61-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
