A2308512
2-Chloro-5-(chloromethyl)pyridine , 97% , 70258-18-3
CAS NO.：70258-18-3
Empirical Formula: C6H5Cl2N
Molecular Weight: 162.02
MDL number: MFCD00125366
EINECS: 615-091-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB232.80 | In Stock |
|
| 500G | RMB635.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-42 °C(lit.) |
| Boiling point: | 267.08°C (rough estimate) |
| Density | 1.4411 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -0.75±0.10(Predicted) |
| form | Moist Crystals |
| color | Beige |
| Water Solubility | Insoluble in water. |
| BRN | 1635690 |
| InChI | InChI=1S/C6H5Cl2N/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,3H2 |
| InChIKey | SKCNYHLTRZIINA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(CCl)C=C1 |
Description and Uses
2-Chloro-5-(chloromethyl)pyridine is used for the synthesis of various pharmaceutical compounds. It can also be used for the synthesis of new neonicotinoid compounds.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P280-P301+P312+P330-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,Xi,F |
| Risk Statements | 22-34-36-10 |
| Safety Statements | 26-36/37/39-45-25-36-16 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Harmful |
| HazardClass | LACHRYMATOR, CORROSIVE |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29333999 |
