A6200612
1-Nitro-4-(trifluoromethoxy)benzene , 98% , 713-65-5
CAS NO.：713-65-5
Empirical Formula: C7H4F3NO3
Molecular Weight: 207.11
MDL number: MFCD00040302
EINECS: 671-689-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB105.60 | In Stock |
|
| 100G | RMB333.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15°C |
| Boiling point: | 87 °C |
| Density | 1,447 g/cm3 |
| refractive index | 1.467 |
| Flash point: | 87-89°C/15mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1966388 |
| InChI | InChI=1S/C7H4F3NO3/c8-7(9,10)14-6-3-1-5(2-4-6)11(12)13/h1-4H |
| InChIKey | UBEIKVUMDBCCRW-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 713-65-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Alpha,alpha,alpha-trifluoro-4'-nitroanisole(713-65-5) |
Description and Uses
1-Nitro-4-(trifluoromethoxy)benzene can be used to manufacture tobacco flavor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37-23 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |
