A5521512
6-Methylnicotinic Acid , 99% , 3222-47-7
Synonym(s):
6-Methylnicotinic acid;6-Methylpyridine-3-carboxylic acid
CAS NO.：3222-47-7
Empirical Formula: C7H7NO2
Molecular Weight: 137.14
MDL number: MFCD00006341
EINECS: 670-942-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB116.00 | In Stock |
|
| 100G | RMB463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-213 °C (lit.) |
| Boiling point: | 251.96°C (rough estimate) |
| Density | 1.2528 (rough estimate) |
| refractive index | 1.5030 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.37±0.10(Predicted) |
| form | Powder, Crystals and/or Chunks |
| color | White to light yellow to beige |
| Water Solubility | Sparingly soluble in water. |
| BRN | 112049 |
| InChI | InChI=1S/C7H7NO2/c1-5-2-3-6(4-8-5)7(9)10/h2-4H,1H3,(H,9,10) |
| InChIKey | RZOKQIPOABEQAM-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC=C1C(O)=O |
Description and Uses
6-Methylnicotinic acid is an intermediate of the drug etoricoxib (a non- steroidal anti-inflammatory drug for the treatment of arthritis and osteoarthritis). It is also used as organic intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
