A5458612
3-Methyl-4-aminopyridine , 98% , 1990-90-5
CAS NO.：1990-90-5
Empirical Formula: C6H8N2
Molecular Weight: 108.14
MDL number: MFCD01704431
EINECS: 217-872-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB223.20 | In Stock |
|
| 25G | RMB767.20 | In Stock |
|
| 100G | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-107 |
| Boiling point: | 192.78°C (rough estimate) |
| Density | 0.9581 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | pK1: 9.43(+1) (25°C) |
| color | Crystals from C6H6/pet ether |
| InChI | InChI=1S/C6H8N2/c1-5-4-8-3-2-6(5)7/h2-4H,1H3,(H2,7,8) |
| InChIKey | VGJLGPCXUGIXRQ-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(N)=C1C |
Description and Uses
4-Amino-3-methylpyridine is a non depolarizing muscular relaxant with antagonist effect that functions on neuromuscular transmission and in central nervous systems in rats. A central cholinergic agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 23/24/25-36/37/38-34-22-20/21/22 |
| Safety Statements | 22-36/37/39-45-36-27-26 |
| RIDADR | 2811 |
| RTECS | TJ5140000 |
| Hazard Note | Harmful |
| HS Code | 29333999 |
| Toxicity | LD50 orl-rat: 446 mg/kg TXAPA9 21,315,72 |
