PRODUCT Properties
| Melting point: | 81.5℃ |
| Density | 1.3575 (rough estimate) |
| refractive index | 1.5790 (estimate) |
| Flash point: | 100 °C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.80±0.70(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | 0.58g/L(room temperature) |
| BRN | 2212523 |
| InChI | InChI=1S/C9H11ClN2O2/c1-12(14-2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
| InChIKey | LKJPSUCKSLORMF-UHFFFAOYSA-N |
| SMILES | N(OC)(C)C(NC1=CC=C(Cl)C=C1)=O |
| EPA Substance Registry System | Monolinuron (1746-81-2) |
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H373-H410 |
| Precautionary statements | P260-P264-P270-P273-P301+P312-P314 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-48/22-50/53 |
| Safety Statements | 22-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | YS6425000 |
| HS Code | 29280000 |
| Hazardous Substances Data | 1746-81-2(Hazardous Substances Data) |
