2-Methoxyphenylboronic acid(contains varying amounts of Anhydride) , 97% , 5720-06-9
Synonym(s):
(2-Methoxyphenyl)boric acid;o-Anisylboronic acid;o-Methoxybenzeneboronic acid;o-Methoxyphenylboronic acid;2-Methoxybenzeneboronic acid
CAS NO.：5720-06-9
Empirical Formula: C7H9BO3
Molecular Weight: 151.96
MDL number: MFCD00236047
EINECS: 611-481-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB164.00 | In Stock |
|
| 100G | RMB574.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 105-110 °C (lit.) |
| Boiling point: | 319.3±44.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 8.55±0.58(Predicted) |
| form | Crystals or Crystalline Powder |
| color | Off-white |
| Water Solubility | Insoluble in water. |
| BRN | 3030981 |
| InChI | InChI=1S/C7H9BO3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5,9-10H,1H3 |
| InChIKey | ROEQGIFOWRQYHD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OC)(O)O |
| CAS DataBase Reference | 5720-06-9(CAS DataBase Reference) |
Description and Uses
2-Methoxyphenylboronic acid is an arylboronic acid. Arylboronic acids can be widely used as safe and environmentally friendly new aromatization reagents for scientific research and production of various fine chemicals containing aryl structures, such as pharmaceuticals, pesticides, and advanced materials. The reactions of arylboronic acids with halogenates play a pivotal role in today's drug synthesis, and such reactions were pioneered by Japanese scientists Suzuki's team, which won the Nobel Prize in Chemistry in 2010.
2-Methoxylphenylboronic acid is a phenylboronic acid used to investigate boron function in plants. It is used in Suzuki reaction, organic reaction that is classified as a coupling reaction where the coupling partners are a boronic acid with a halide catalyzed by a palladium(0) complex.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
