A5295012
Liothyronine Sodium , ≥97% , 55-06-1
Synonym(s):
3,3′,5-Triiodo-L -thyronine sodium salt;Liothyronine;O-(4-Hydroxy-3-iodophenyl)-3,5-diiodo-L -tyrosine sodium salt;T3
CAS NO.：55-06-1
Empirical Formula: C15H11I3NNaO4
Molecular Weight: 672.96
MDL number: MFCD00002594
EINECS: 200-223-5
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB225.60 | In Stock |
|
| 1G | RMB230.40 | In Stock |
|
| 500MG | RMB791.20 | In Stock |
|
| 5G | RMB1078.40 | In Stock |
|
| 25g | RMB3839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205 °C (dec.)(lit.) |
| alpha | 20 º (c=2,alcohol/1.2N HCl) |
| RTECS | YP2836500 |
| storage temp. | -20°C |
| solubility | 4 M NH4OH in methanol: 125 g/5mL, clear, yellow-brown |
| form | powder |
| color | White to Pale Brown |
| Water Solubility | Partly miscible in water. Soluble in dimethyl sulfoxide, methanol, sodium hydroxide and ethanol. Practically insoluble in most other organic solvents. |
| Sensitive | Light Sensitive |
| Merck | 5510 |
| BRN | 8179867 |
| InChI | InChI=1/C15H12I3NO4.Na/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22;/h1-4,6,12,20H,5,19H2,(H,21,22);/q;+1/p-1/t12-;/s3 |
| InChIKey | SBXXSUDPJJJJLC-ZLBVLXFENA-M |
| SMILES | C1(C(I)=CC(C[C@H](N)C([O-])=O)=CC=1I)OC1=CC=C(O)C(I)=C1.[Na+] |&1:6,r| |
Description and Uses
One of the hormones produced by the thyroid gland that is involved in the maintenance of metabolic homeostasis. Also produced in peripheral tissues as the active metabolite of Thyroxine.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-24/25-36 |
| WGK Germany | 3 |
| F | 3-8-10 |
| HS Code | 29379000 |
