A5067712
3-Isochromanone , >99.0%(GC) , 4385-35-7
CAS NO.：4385-35-7
Empirical Formula: C9H8O2
Molecular Weight: 148.16
MDL number: MFCD00043005
EINECS: 224-493-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB34.40 | In Stock |
|
| 100G | RMB98.40 | In Stock |
|
| 500g | RMB398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-82 °C (lit.) |
| Boiling point: | 130 °C / 1mmHg |
| Density | 1.196±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Beige |
| BRN | 123692 |
| InChI | InChI=1S/C9H8O2/c10-9-5-7-3-1-2-4-8(7)6-11-9/h1-4H,5-6H2 |
| InChIKey | ILHLUZUMRJQEAH-UHFFFAOYSA-N |
| SMILES | C1(=O)OCC2=CC=CC=C2C1 |
Description and Uses
3-Isochromanone may be used as starting reagent in the synthesis of of BDPBI (7-bromo-1,4-dihydro-2-phenyl-4,4-bis(4-pyridinylmethyl)2H-isoquinolin-3-one dihydrochloride).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2932990090 |
