A5061612
<I>trans</I>-β-Methyl-β-nitrostyrene , 98% , 705-60-2
CAS NO.：705-60-2
Empirical Formula: C9H9NO2
Molecular Weight: 163.17
MDL number: MFCD00014720
EINECS: 627-363-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB233.60 | In Stock |
|
| 100G | RMB768.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-65 °C (lit.) |
| Boiling point: | 263.0±9.0 °C(Predicted) |
| Density | 1.141±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetone, Chloroform, Dichloromethane, Methanol |
| form | Crystalline Powder |
| color | Yellow |
| InChI | InChI=1S/C9H9NO2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | WGSVFWFSJDAYBM-BQYQJAHWSA-N |
| SMILES | C1(C=C([N+]([O-])=O)C)=CC=CC=C1 |
Description and Uses
1-phenyl-2-nitropropene is used in the production of pharmaceuticals, for instance, for drug Adderall, a drug used to treat ADHD and narcolepsy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | DA6495000 |
| HS Code | 29042090 |
