A5015112
2',3'-O-Isopropylideneinosine , 98% , 2140-11-6
CAS NO.：2140-11-6
Empirical Formula: C13H16N4O5
Molecular Weight: 308.29
MDL number: MFCD00038002
EINECS: 218-388-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25g | RMB225.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 263-272°C |
| Boiling point: | 606.6±65.0 °C(Predicted) |
| Density | 1.80±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 14.14±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C13H16N4O5/c1-13(2)21-8-6(3-18)20-12(9(8)22-13)17-5-16-7-10(17)14-4-15-11(7)19/h4-6,8-9,12,18H,3H2,1-2H3,(H,14,15,19)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | LIEKLUBCIPVWQD-WOUKDFQISA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)O)N=C2)[C@@H]2OC(O[C@H]12)(C)C |
| CAS DataBase Reference | 2140-11-6(CAS DataBase Reference) |
Description and Uses
2',3'-O-Isopropylideneinosine is an inosine derivative as antiviral, bactericidal, and antitumor agent for immunopotentiating uses.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29389090 |
