PRODUCT Properties
| Boiling point: | 255-260 °C2 mm Hg(lit.) |
| Density | 1.04 g/mL at 25 °C(lit.) |
| vapor pressure | 2Pa at 25℃ |
| refractive index | n |
| Flash point: | 185 °F |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Water Solubility | 16.85g/L at 20℃ |
| InChI | InChI=1S/C9H11N3/c10-6-2-1-4-9(8-12)5-3-7-11/h9H,1-5H2 |
| InChIKey | LNLFLMCWDHZINJ-UHFFFAOYSA-N |
| SMILES | C(C#N)CC(C#N)CCCC#N |
| LogP | -0.34 at 30℃ |
Description and Uses
1,3,6-Hexanetricarbonitrile is mainly used as an intermediate in organic synthesis, as a high boiling point solvent and as an additive to electrolytes.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H227-H301+H311+H331-H315-H319 |
| Precautionary statements | P210-P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P370+P378-P403+P233-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 23-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
