A4820912
1,1,1,3,3,3-Hexafluoroisopropyl <i>p</i>-Toluenesulfonate , >95.0%(GC) , 67674-48-0
CAS NO.：67674-48-0
Empirical Formula: C10H8F6O3S
Molecular Weight: 322.22
MDL number: MFCD00039262
EINECS: 266-887-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB168.80 | In Stock |
|
| 25G | RMB600.00 | In Stock |
|
| 100g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39 °C |
| Boiling point: | 134°C/22.5mmHg(lit.) |
| Density | 1.464±0.06 g/cm3(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 4530866 |
| InChI | InChI=1S/C10H8F6O3S/c1-6-2-4-7(5-3-6)20(17,18)19-8(9(11,12)13)10(14,15)16/h2-5,8H,1H3 |
| InChIKey | QGSVBFAODCJVIZ-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(OS(C1=CC=C(C)C=C1)(=O)=O)C(F)(F)F |
| CAS DataBase Reference | 67674-48-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanol, 1,1,1,3,3,3-hexafluoro-, 4-methylbenzenesulfonate (67674-48-0) |
Description and Uses
Hexafluoroisopropyl Tosylate (CAS# 67674-48-0) can be used to manufacture composite reverse osmosis membrane for water treatment.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
